Difference between revisions of "PLASMENYLCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03058 == * transcription-direction: ** positive * right-end-position: ** 77727 * left-end-position: ** 55960 * centisome-position: ** 10.554966...") |
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-GLUTAMATE-5-P == |
− | * | + | * common-name: |
− | ** | + | ** γ-l-glutamyl 5-phosphate |
− | + | * smiles: | |
− | + | ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o | |
− | + | * inchi-key: | |
− | + | ** pjrxvijaernuip-vkhmyheasa-l | |
− | * | + | * molecular-weight: |
− | ** | + | ** 225.094 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[G5DH]] | |
− | = | + | * [[G5DHm]] |
− | + | * [[GLUTSEMIALDEHYDROG-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GLUTKIN-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=γ-l-glutamyl 5-phosphate}} | |
− | ** | + | {{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}} |
− | + | {{#set: molecular-weight=225.094}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite L-GLUTAMATE-5-P
- common-name:
- γ-l-glutamyl 5-phosphate
- smiles:
- c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
- inchi-key:
- pjrxvijaernuip-vkhmyheasa-l
- molecular-weight:
- 225.094