Difference between revisions of "PLPSAL-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc...")
(Created page with "Category:pathway == Pathway PLPSAL-PWY == * taxonomic-range: ** tax-33208 ** tax-4751 ** tax-2 ** tax-33090 * common-name: ** pyridoxal 5'-phosphate salvage i == Reaction(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] ==
+
== Pathway PLPSAL-PWY ==
 +
* taxonomic-range:
 +
** tax-33208
 +
** tax-4751
 +
** tax-2
 +
** tax-33090
 
* common-name:
 
* common-name:
** ferulate
+
** pyridoxal 5'-phosphate salvage i
* smiles:
+
== Reaction(s) found ==
** coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
+
* [[PMPOXI-RXN]]
* inchi-key:
+
* [[PNKIN-RXN]]
** ksebmyqbyztdhs-hwkanzrosa-m
+
* [[PNPOXI-RXN]]
* molecular-weight:
+
* [[PYRAMKIN-RXN]]
** 193.179
+
* [[PYRIDOXKIN-RXN]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[6.2.1.34-RXN]]
+
All reactions of this pathways are in present
* [[RXN-1121]]
+
{{#set: taxonomic-range=tax-4751|tax-33208|tax-2|tax-33090}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=pyridoxal 5'-phosphate salvage i}}
* [[3.1.1.73-RXN]]
+
{{#set: nb reaction found=5}}
* [[RXN-1104]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=5}}
{{#set: common-name=ferulate}}
 
{{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}}
 
{{#set: molecular-weight=193.179}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PLPSAL-PWY

  • taxonomic-range:
    • tax-33208
    • tax-4751
    • tax-2
    • tax-33090
  • common-name:
    • pyridoxal 5'-phosphate salvage i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present