Difference between revisions of "PLPSAL-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] ==
+== Pathway PWY-5703 ==
+* taxonomic-range:
+** tax-2
+** tax-3041
+** tax-2763
+** tax-4751
 * common-name:
-** ferulate
+** urea degradation i
-* smiles:
+== Reaction(s) found ==
-** coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
+* [[ALLOPHANATE-HYDROLASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ksebmyqbyztdhs-hwkanzrosa-m
+* [NoneRXN0-5222 RXN0-5222]
-* molecular-weight:
+* [NoneUREA-CARBOXYLASE-RXN UREA-CARBOXYLASE-RXN]
-** 193.179
+* [NoneRXN-20065 RXN-20065]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-3041|tax-4751|tax-2763}}
-* [[6.2.1.34-RXN]]
+{{#set: common-name=urea degradation i}}
-* [[RXN-1121]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[3.1.1.73-RXN]]
+{{#set: nb total reaction=3}}
-* [[RXN-1104]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=ferulate}}
-{{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}}
-{{#set: molecular-weight=193.179}}