Difference between revisions of "POLYPEPTIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite POLYPEPTIDE == * common-name: ** a polypeptide == Reaction(s) known to consume the compound == * 3.4.14.10-RXN * 3.4.14.5-RXN * [...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite POLYPEPTIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a polypeptide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.4.14.10-RXN]] | ||
| + | * [[3.4.14.5-RXN]] | ||
| + | * [[3.4.14.9-RXN]] | ||
| + | * [[3.4.24.56-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a polypeptide}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite POLYPEPTIDE
- common-name:
- a polypeptide
