Difference between revisions of "PPGPPMET-PWY"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-3-METHYL-GLUTARYL-COA 3-HYDROXY-3-METHYL-GLUTARYL-COA] ==
+== Pathway PPGPPMET-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (s)-3-hydroxy-3-methylglutaryl-coa
+** ppgpp biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(c)(o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[GDPKIN-RXN]]
-* inchi-key:
+* [[GDPPYPHOSKIN-RXN]]
-** cabvtrnmfuvudm-vrhqgpglsa-i
+* [[GTPPYPHOSKIN-RXN]]
-* molecular-weight:
+* [[PPGPPSYN-RXN]]
-** 906.621
+* [[RXN0-6427]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-* [[1.1.1.34-RXN]]
+* [NonePPPGPPHYDRO-RXN PPPGPPHYDRO-RXN]
-* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
+{{#set: taxonomic-range=tax-2}}
-* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+{{#set: common-name=ppgpp biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=5}}
-* [[1.1.1.34-RXN]]
+{{#set: completion rate=0.83}}
-* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+{{#set: nb total reaction=6}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxy-3-methylglutaryl-coa}}
-{{#set: inchi-key=inchikey=cabvtrnmfuvudm-vrhqgpglsa-i}}
-{{#set: molecular-weight=906.621}}