Difference between revisions of "PPI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite Oligomers-Of-Galactosamines == * common-name: ** an oligomer of galactosamine == Reaction(s) known to consume the compound == == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7214 ==
+
== Metabolite Oligomers-Of-Galactosamines ==
 
* common-name:
 
* common-name:
** (2s)-dihydrotricetin
+
** an oligomer of galactosamine
* smiles:
 
** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
 
* inchi-key:
 
** usqxpewrywrrjd-lbprgkrzsa-m
 
* molecular-weight:
 
** 303.248
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7922]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.109-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-dihydrotricetin}}
+
{{#set: common-name=an oligomer of galactosamine}}
{{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}}
 
{{#set: molecular-weight=303.248}}
 

Revision as of 14:57, 5 January 2021

Metabolite Oligomers-Of-Galactosamines

  • common-name:
    • an oligomer of galactosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality