Difference between revisions of "PRECURSOR-Z"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Oxidized == * common-name: ** an oxidized c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RX...") |
(Created page with "Category:metabolite == Metabolite 2-3-DIHYDROXYBENZOATE == * common-name: ** 2,3-dihydroxybenzoate * smiles: ** c(c1(=cc=cc(=c1o)o))([o-])=o * inchi-key: ** gldqamycgoijdv...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-3-DIHYDROXYBENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,3-dihydroxybenzoate |
| + | * smiles: | ||
| + | ** c(c1(=cc=cc(=c1o)o))([o-])=o | ||
| + | * inchi-key: | ||
| + | ** gldqamycgoijdv-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 153.114 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DHBDEHYD-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,3-dihydroxybenzoate}} |
| + | {{#set: inchi-key=inchikey=gldqamycgoijdv-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=153.114}} | ||
Revision as of 11:14, 15 January 2021
Contents
Metabolite 2-3-DIHYDROXYBENZOATE
- common-name:
- 2,3-dihydroxybenzoate
- smiles:
- c(c1(=cc=cc(=c1o)o))([o-])=o
- inchi-key:
- gldqamycgoijdv-uhfffaoysa-m
- molecular-weight:
- 153.114
