Difference between revisions of "PRECURSOR-Z"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17388 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc...")
(Created page with "Category:metabolite == Metabolite PRECURSOR-Z == * common-name: ** cyclic pyranopterin phosphate * smiles: ** c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17388 ==
+
== Metabolite PRECURSOR-Z ==
 
* common-name:
 
* common-name:
** 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** cyclic pyranopterin phosphate
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o)4))))
 
* inchi-key:
 
* inchi-key:
** dnhdpaxpqgygij-kwfbmmabsa-j
+
** pwfxlxmpgsleoz-qqvwsjfjsa-m
 
* molecular-weight:
 
* molecular-weight:
** 1116.018
+
** 344.2
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16137]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17809]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=cyclic pyranopterin phosphate}}
{{#set: inchi-key=inchikey=dnhdpaxpqgygij-kwfbmmabsa-j}}
+
{{#set: inchi-key=inchikey=pwfxlxmpgsleoz-qqvwsjfjsa-m}}
{{#set: molecular-weight=1116.018}}
+
{{#set: molecular-weight=344.2}}

Latest revision as of 11:12, 18 March 2021

Metabolite PRECURSOR-Z

  • common-name:
    • cyclic pyranopterin phosphate
  • smiles:
    • c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o)4))))
  • inchi-key:
    • pwfxlxmpgsleoz-qqvwsjfjsa-m
  • molecular-weight:
    • 344.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality