Difference between revisions of "PRECURSOR-Z"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m...") |
(Created page with "Category:metabolite == Metabolite PRECURSOR-Z == * common-name: ** cyclic pyranopterin phosphate * smiles: ** c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PRECURSOR-Z == |
* common-name: | * common-name: | ||
| − | ** | + | ** cyclic pyranopterin phosphate |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o)4)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pwfxlxmpgsleoz-qqvwsjfjsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 344.2 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-17809]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cyclic pyranopterin phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pwfxlxmpgsleoz-qqvwsjfjsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=344.2}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PRECURSOR-Z
- common-name:
- cyclic pyranopterin phosphate
- smiles:
- c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o)4))))
- inchi-key:
- pwfxlxmpgsleoz-qqvwsjfjsa-m
- molecular-weight:
- 344.2
