Difference between revisions of "PRECURSOR-Z"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-methylcytosine2870-in-25S-rRNA == * common-name: ** a 5-methylcytosine2870 in 25s rrna == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-9699 == * common-name: ** hypoglycin a * smiles: ** c=c1(c(cc([n+])c([o-])=o)c1) * inchi-key: ** oojzcxfxpzgubj-uhfffaoysa-n * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9699 == |
* common-name: | * common-name: | ||
| − | ** a | + | ** hypoglycin a |
| + | * smiles: | ||
| + | ** c=c1(c(cc([n+])c([o-])=o)c1) | ||
| + | * inchi-key: | ||
| + | ** oojzcxfxpzgubj-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 141.169 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9157]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=a | + | {{#set: common-name=hypoglycin a}} |
| + | {{#set: inchi-key=inchikey=oojzcxfxpzgubj-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=141.169}} | ||
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-9699
- common-name:
- hypoglycin a
- smiles:
- c=c1(c(cc([n+])c([o-])=o)c1)
- inchi-key:
- oojzcxfxpzgubj-uhfffaoysa-n
- molecular-weight:
- 141.169
