Difference between revisions of "PRECURSOR-Z"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9699 == * common-name: ** hypoglycin a * smiles: ** c=c1(c(cc([n+])c([o-])=o)c1) * inchi-key: ** oojzcxfxpzgubj-uhfffaoysa-n * molecu...")
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Oxidized == * common-name: ** an oxidized c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RX...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9699 ==
+
== Metabolite Cytochromes-C-Oxidized ==
 
* common-name:
 
* common-name:
** hypoglycin a
+
** an oxidized c-type cytochrome
* smiles:
 
** c=c1(c(cc([n+])c([o-])=o)c1)
 
* inchi-key:
 
** oojzcxfxpzgubj-uhfffaoysa-n
 
* molecular-weight:
 
** 141.169
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9157]]
+
* [[1.10.2.2-RXN]]
 +
* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
 +
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 +
* [[RXN-14107]]
 +
* [[RXN-15816]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.10.2.2-RXN]]
 +
* [[CYTOCHROME-C-OXIDASE-RXN]]
 +
* [[CYTOCHROME-C-PEROXIDASE-RXN]]
 +
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 +
* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
 +
* [[RXN-15830]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hypoglycin a}}
+
{{#set: common-name=an oxidized c-type cytochrome}}
{{#set: inchi-key=inchikey=oojzcxfxpzgubj-uhfffaoysa-n}}
 
{{#set: molecular-weight=141.169}}
 

Revision as of 18:54, 14 January 2021