Difference between revisions of "PREGNENOLONE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02273 == * transcription-direction: ** positive * right-end-position: ** 538614 * left-end-position: ** 517631 * centisome-position: ** 95.290085...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-1-P == * common-name: ** n-acetyl-α-d-glucosamine 1-phosphate * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite N-ACETYL-D-GLUCOSAMINE-1-P == |
| − | * | + | * common-name: |
| − | ** | + | ** n-acetyl-α-d-glucosamine 1-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** fzljpepaypummr-fmdgeedcsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 299.174 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[NAG1P-URIDYLTRANS-RXN]] |
| − | == Reaction(s) | + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] |
| − | * [[RXN | + | == Reaction(s) known to produce the compound == |
| − | + | * [[2.3.1.157-RXN]] | |
| − | + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | |
| − | * [[ | + | * [[RXN-16426]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=n-acetyl-α-d-glucosamine 1-phosphate}} | |
| − | == | + | {{#set: inchi-key=inchikey=fzljpepaypummr-fmdgeedcsa-l}} |
| − | + | {{#set: molecular-weight=299.174}} | |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-1-P
- common-name:
- n-acetyl-α-d-glucosamine 1-phosphate
- smiles:
- cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)([o-])[o-])1)
- inchi-key:
- fzljpepaypummr-fmdgeedcsa-l
- molecular-weight:
- 299.174
