Difference between revisions of "PREGNENOLONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Sterol-3-beta-D-glucosides == * common-name: ** a sterol 3-β-d-glucoside == Reaction(s) known to consume the compound == == Reaction...")
(Created page with "Category:metabolite == Metabolite CPD-11521 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(sccnc(=o)ccn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Sterol-3-beta-D-glucosides ==
+
== Metabolite CPD-11521 ==
 
* common-name:
 
* common-name:
** a sterol 3-β-d-glucoside
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa
 +
* smiles:
 +
** ccc=ccc1(c(ccc(=o)1)cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 +
* inchi-key:
 +
** vwfuyqvgvaevnh-wzglbkmisa-j
 +
* molecular-weight:
 +
** 1011.867
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10706]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
+
* [[RXN-10699]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sterol 3-β-d-glucoside}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa}}
 +
{{#set: inchi-key=inchikey=vwfuyqvgvaevnh-wzglbkmisa-j}}
 +
{{#set: molecular-weight=1011.867}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-11521

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • vwfuyqvgvaevnh-wzglbkmisa-j
  • molecular-weight:
    • 1011.867

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality