Difference between revisions of "PRENAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(...")
(Created page with "Category:metabolite == Metabolite PRENAL == * common-name: ** 3-methyl-2-butenal * smiles: ** cc(=c[ch]=o)c * inchi-key: ** sepqtyodoklvsb-uhfffaoysa-n * molecular-weight:...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12575 ==
+
== Metabolite PRENAL ==
 
* common-name:
 
* common-name:
** udp-α-d-glucose
+
** 3-methyl-2-butenal
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
** cc(=c[ch]=o)c
 
* inchi-key:
 
* inchi-key:
** hscjrczfdfqwrp-jzmiexbbsa-l
+
** sepqtyodoklvsb-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 564.289
+
** 84.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[1.5.99.12-RXN]]
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 
* [[2.4.1.117-RXN]]
 
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-12123]]
 
* [[RXN-12125]]
 
* [[RXN-12126]]
 
* [[RXN-12127]]
 
* [[RXN-12128]]
 
* [[RXN-1223]]
 
* [[RXN-15117]]
 
* [[RXN-16975]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-5482]]
 
* [[RXN-7667]]
 
* [[RXN-7828]]
 
* [[RXN-8228]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UDPGth]]
 
* [[UG4E]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[1.5.99.12-RXN]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[1.8.3.5-RXN]]
* [[UDPGLUCEPIM-RXN]]
+
* [[RXN-11989]]
* [[UDPGth]]
 
* [[UG1PUT]]
 
* [[UG4E]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-&alpha;-d-glucose}}
+
{{#set: common-name=3-methyl-2-butenal}}
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
+
{{#set: inchi-key=inchikey=sepqtyodoklvsb-uhfffaoysa-n}}
{{#set: molecular-weight=564.289}}
+
{{#set: molecular-weight=84.118}}

Latest revision as of 11:14, 18 March 2021

Metabolite PRENAL

  • common-name:
    • 3-methyl-2-butenal
  • smiles:
    • cc(=c[ch]=o)c
  • inchi-key:
    • sepqtyodoklvsb-uhfffaoysa-n
  • molecular-weight:
    • 84.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality