Difference between revisions of "PRENAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite PRENAL == * common-name: ** 3-methyl-2-butenal * smiles: ** cc(=c[ch]=o)c * inchi-key: ** sepqtyodoklvsb-uhfffaoysa-n * molecular-weight:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PRENAL == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-methyl-2-butenal |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=c[ch]=o)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sepqtyodoklvsb-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 84.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[1.5.99.12-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.5.99.12-RXN]] |
+ | * [[1.8.3.5-RXN]] | ||
+ | * [[RXN-11989]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-methyl-2-butenal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sepqtyodoklvsb-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=84.118}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PRENAL
- common-name:
- 3-methyl-2-butenal
- smiles:
- cc(=c[ch]=o)c
- inchi-key:
- sepqtyodoklvsb-uhfffaoysa-n
- molecular-weight:
- 84.118