Difference between revisions of "PRENAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22543 == * transcription-direction: ** negative * right-end-position: ** 34582 * left-end-position: ** 30740 * centisome-position: ** 17.654491...")
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ22543 ==
+
== Metabolite CPD-9871 ==
* transcription-direction:
+
* common-name:
** negative
+
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
* right-end-position:
+
* smiles:
** 34582
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
* left-end-position:
+
* inchi-key:
** 30740
+
** xcoxsblqzpfvgk-rgiwonjesa-n
* centisome-position:
+
* molecular-weight:
** 17.654491   
+
** 835.347
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-9235]]
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
** Category: [[orthology]]
+
{{#set: molecular-weight=835.347}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=34582}}
 
{{#set: left-end-position=30740}}
 
{{#set: centisome-position=17.654491    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-9871

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xcoxsblqzpfvgk-rgiwonjesa-n
  • molecular-weight:
    • 835.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality