Difference between revisions of "PRENAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HCN == * common-name: ** hydrogen cyanide * smiles: ** c#n * inchi-key: ** lelowrisymnnsu-uhfffaoysa-n * molecular-weight: ** 27.026 == R...") |
(Created page with "Category:metabolite == Metabolite CPD-19153 == * common-name: ** 3-oxo-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19153 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-(5z)-dodecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** c | + | ** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vklhslowdwgvgp-cggpsvllsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 957.775 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17799]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-17798]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-(5z)-dodecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vklhslowdwgvgp-cggpsvllsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=957.775}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-19153
- common-name:
- 3-oxo-(5z)-dodecenoyl-coa
- smiles:
- ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- vklhslowdwgvgp-cggpsvllsa-j
- molecular-weight:
- 957.775
