Difference between revisions of "PREPHENATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00472 == * transcription-direction: ** positive * right-end-position: ** 128401 * left-end-position: ** 126290 * centisome-position: ** 75.81206...")
(Created page with "Category:metabolite == Metabolite PREPHENATE == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1) * inchi-key: ** fpwmcupfbrfmlh-xgaoum...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00472 ==
+
== Metabolite PREPHENATE ==
* transcription-direction:
+
* common-name:
** positive
+
** prephenate
* right-end-position:
+
* smiles:
** 128401
+
** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1)
* left-end-position:
+
* inchi-key:
** 126290
+
** fpwmcupfbrfmlh-xgaoumnusa-l
* centisome-position:
+
* molecular-weight:
** 75.81206   
+
** 224.17
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CHORISMATEMUT-RXN]]
== Reaction(s) associated ==
+
* [[PPDH]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
** Category: [[annotation]]
+
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PREPHENATE-TRANSAMINE-RXN]]
{{#set: transcription-direction=positive}}
+
* [[PREPHENATEDEHYDRAT-RXN]]
{{#set: right-end-position=128401}}
+
* [[PREPHENATEDEHYDROG-RXN]]
{{#set: left-end-position=126290}}
+
== Reaction(s) known to produce the compound ==
{{#set: centisome-position=75.81206    }}
+
* [[CHORISMATEMUT-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
{{#set: nb reaction associated=1}}
+
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=prephenate}}
 +
{{#set: inchi-key=inchikey=fpwmcupfbrfmlh-xgaoumnusa-l}}
 +
{{#set: molecular-weight=224.17}}

Latest revision as of 11:11, 18 March 2021

Metabolite PREPHENATE

  • common-name:
    • prephenate
  • smiles:
    • c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1)
  • inchi-key:
    • fpwmcupfbrfmlh-xgaoumnusa-l
  • molecular-weight:
    • 224.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality