Difference between revisions of "PREPHENATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Adenine-58 == * common-name: ** an adenine58 in trna == Reaction(s) known to consume the compound == * RXN-12466 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite PREPHENATE == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1) * inchi-key: ** fpwmcupfbrfmlh-xgaoum...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-Adenine-58 ==
+
== Metabolite PREPHENATE ==
 
* common-name:
 
* common-name:
** an adenine58 in trna
+
** prephenate
 +
* smiles:
 +
** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1)
 +
* inchi-key:
 +
** fpwmcupfbrfmlh-xgaoumnusa-l
 +
* molecular-weight:
 +
** 224.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12466]]
+
* [[CHORISMATEMUT-RXN]]
 +
* [[PPDH]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[PREPHENATEDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CHORISMATEMUT-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an adenine58 in trna}}
+
{{#set: common-name=prephenate}}
 +
{{#set: inchi-key=inchikey=fpwmcupfbrfmlh-xgaoumnusa-l}}
 +
{{#set: molecular-weight=224.17}}

Latest revision as of 11:11, 18 March 2021

Metabolite PREPHENATE

  • common-name:
    • prephenate
  • smiles:
    • c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1)
  • inchi-key:
    • fpwmcupfbrfmlh-xgaoumnusa-l
  • molecular-weight:
    • 224.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality