Difference between revisions of "PREPHENATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13375 == * common-name: ** xxxg xyloglucan oligosaccharide * smiles: ** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c...")
(Created page with "Category:metabolite == Metabolite Myelin-L-arginines == * common-name: ** [myelin basic protein]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.126-R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13375 ==
+
== Metabolite Myelin-L-arginines ==
 
* common-name:
 
* common-name:
** xxxg xyloglucan oligosaccharide
+
** [myelin basic protein]-l-arginine
* smiles:
 
** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)
 
* inchi-key:
 
** pzupagrihcrvkn-sphbqonksa-n
 
* molecular-weight:
 
** 1062.931
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.126-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12398]]
 
* [[RXN-12399]]
 
* [[RXN-12400]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xxxg xyloglucan oligosaccharide}}
+
{{#set: common-name=[myelin basic protein]-l-arginine}}
{{#set: inchi-key=inchikey=pzupagrihcrvkn-sphbqonksa-n}}
 
{{#set: molecular-weight=1062.931}}
 

Revision as of 14:53, 5 January 2021

Metabolite Myelin-L-arginines

  • common-name:
    • [myelin basic protein]-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "myelin basic protein]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.