Difference between revisions of "PREPHENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Myelin-L-arginines == * common-name: ** [myelin basic protein]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.126-R...") |
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYCYTIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-deoxycytidine |
| + | * smiles: | ||
| + | ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) | ||
| + | * inchi-key: | ||
| + | ** cktsbutuhbmzgz-shyzeuofsa-n | ||
| + | * molecular-weight: | ||
| + | ** 227.219 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CYTIDEAM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-deoxycytidine}} |
| + | {{#set: inchi-key=inchikey=cktsbutuhbmzgz-shyzeuofsa-n}} | ||
| + | {{#set: molecular-weight=227.219}} | ||
Revision as of 15:24, 5 January 2021
Contents
Metabolite DEOXYCYTIDINE
- common-name:
- 2'-deoxycytidine
- smiles:
- c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
- inchi-key:
- cktsbutuhbmzgz-shyzeuofsa-n
- molecular-weight:
- 227.219
