Difference between revisions of "PREPHENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...") |
(Created page with "Category:metabolite == Metabolite tRNA-Adenine-58 == * common-name: ** an adenine58 in trna == Reaction(s) known to consume the compound == * RXN-12466 == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Adenine-58 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an adenine58 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12466]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an adenine58 in trna}} |
| − | |||
| − | |||
Revision as of 13:07, 14 January 2021
Contents
Metabolite tRNA-Adenine-58
- common-name:
- an adenine58 in trna
