Difference between revisions of "PREPHENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Adenine-58 == * common-name: ** an adenine58 in trna == Reaction(s) known to consume the compound == * RXN-12466 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-17383 == * common-name: ** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17383 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa |
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
+ | * inchi-key: | ||
+ | ** mmzjvinjfsrjok-cynjbpnesa-j | ||
+ | * molecular-weight: | ||
+ | ** 1102.034 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-16130]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}} | ||
+ | {{#set: molecular-weight=1102.034}} |
Revision as of 18:52, 14 January 2021
Contents
Metabolite CPD-17383
- common-name:
- (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- mmzjvinjfsrjok-cynjbpnesa-j
- molecular-weight:
- 1102.034