Difference between revisions of "PREPHENATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Adenine-58 == * common-name: ** an adenine58 in trna == Reaction(s) known to consume the compound == * RXN-12466 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-17383 == * common-name: ** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-Adenine-58 ==
+
== Metabolite CPD-17383 ==
 
* common-name:
 
* common-name:
** an adenine58 in trna
+
** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** mmzjvinjfsrjok-cynjbpnesa-j
 +
* molecular-weight:
 +
** 1102.034
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12466]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16130]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an adenine58 in trna}}
+
{{#set: common-name=(2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
 +
{{#set: molecular-weight=1102.034}}

Revision as of 18:52, 14 January 2021

Metabolite CPD-17383

  • common-name:
    • (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • mmzjvinjfsrjok-cynjbpnesa-j
  • molecular-weight:
    • 1102.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality