Difference between revisions of "PRISTANATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...") |
(Created page with "Category:metabolite == Metabolite HEXANOATE == * common-name: ** hexanoate * smiles: ** cccccc([o-])=o * inchi-key: ** fuzzwvxgsfpdmh-uhfffaoysa-m * molecular-weight: ** 1...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HEXANOATE == |
* common-name: | * common-name: | ||
− | ** | + | ** hexanoate |
* smiles: | * smiles: | ||
− | ** | + | ** cccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fuzzwvxgsfpdmh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 115.152 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]] |
+ | * [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]] | ||
+ | * [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hexanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fuzzwvxgsfpdmh-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=115.152}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite HEXANOATE
- common-name:
- hexanoate
- smiles:
- cccccc([o-])=o
- inchi-key:
- fuzzwvxgsfpdmh-uhfffaoysa-m
- molecular-weight:
- 115.152
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.
- ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.
- [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]