Difference between revisions of "PRO-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYACETONE == * common-name: ** dihydroxyacetone * smiles: ** c(c(co)=o)o * inchi-key: ** rxkjfzqqpqgtfl-uhfffaoysa-n * molecular-w...") |
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-730 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bzxzfdkirzbjep-jmtmcxqrsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 293.425 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=293.425}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-730
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
- inchi-key:
- bzxzfdkirzbjep-jmtmcxqrsa-m
- molecular-weight:
- 293.425
