Difference between revisions of "PRO-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13851 == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite PRO-tRNAs == * common-name: ** a trnapro == Reaction(s) known to consume the compound == * PROLINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13851 ==
+
== Metabolite PRO-tRNAs ==
 
* common-name:
 
* common-name:
** 2-hydroxy-datp
+
** a trnapro
* smiles:
 
** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
** uoacbprdwrdehj-kvqbguixsa-j
 
* molecular-weight:
 
** 503.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6957]]
+
* [[PROLINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-datp}}
+
{{#set: common-name=a trnapro}}
{{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}}
 
{{#set: molecular-weight=503.152}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite PRO-tRNAs

  • common-name:
    • a trnapro

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality