Difference between revisions of "PROPANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13559 == * common-name: ** α-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-pqmkyfcfsa-...") |
(Created page with "Category:metabolite == Metabolite PROPANOL == * common-name: ** propan-1-ol * smiles: ** ccco * inchi-key: ** bdernnfjnopaec-uhfffaoysa-n * molecular-weight: ** 60.096 ==...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROPANOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** propan-1-ol |
* smiles: | * smiles: | ||
| − | ** | + | ** ccco |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bdernnfjnopaec-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 60.096 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13198]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13198]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=propan-1-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bdernnfjnopaec-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=60.096}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite PROPANOL
- common-name:
- propan-1-ol
- smiles:
- ccco
- inchi-key:
- bdernnfjnopaec-uhfffaoysa-n
- molecular-weight:
- 60.096
