Difference between revisions of "PROPANOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.39-RXN 1.1.1.39-RXN] == * direction: ** left-to-right * common-name: ** malate dehydrogenase...")
(Created page with "Category:metabolite == Metabolite GDP == * common-name: ** gdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** qgw...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.39-RXN 1.1.1.39-RXN] ==
+
== Metabolite GDP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** malate dehydrogenase (decarboxylating) (nad+)
+
** gdp
−
** oxaloacetate decarboxylase
+
* smiles:
−
** malate dehydrogenase, nad-requiring
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
−
* ec-number:
+
* inchi-key:
−
** [http://enzyme.expasy.org/EC/1.1.1.38 ec-1.1.1.38]
+
** qgwndrxfnxrzmb-uuokfmhzsa-k
−
** [http://enzyme.expasy.org/EC/1.1.1.39 ec-1.1.1.39]
+
* molecular-weight:
−
== Reaction formula ==
+
** 440.179
−
* 1 [[MAL]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PYRUVATE]][c]
+
== Reaction(s) known to consume the compound ==
−
== Gene(s) associated with this reaction  ==
+
* [[2.4.1.221-RXN]]
−
* Gene: [[SJ14191]]
+
* [[ATGD]]
−
** Category: [[annotation]]
+
* [[DGOTO]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GBDP]]
−
** Category: [[orthology]]
+
* [[GDPKIN-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[GDPPYPHOSKIN-RXN]]
−
* Gene: [[SJ13180]]
+
* [[GDPREDUCT-RXN]]
−
** Category: [[annotation]]
+
* [[GTPOP]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
−
* Gene: [[SJ11643]]
+
* [[MANNPGUANYLTRANGDP-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-12486]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-14117]]
−
** Category: [[orthology]]
+
* [[RXN-15268]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN0-748]]
−
== Pathway(s) ==
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
−
* [[PWY-7118]], chitin degradation to ethanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118]
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
−
** '''5''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
** '''12''' reactions found over '''13''' reactions in the full pathway
+
* [[2.4.1.142-RXN]]
−
* [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
+
* [[2.4.1.221-RXN]]
−
** '''9''' reactions found over '''10''' reactions in the full pathway
+
* [[2.4.1.68-RXN]]
−
* [[PWY-7686]], L-malate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7686 PWY-7686]
+
* [[2.4.1.83-RXN]]
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
−
* [[PWY-3641]], L-carnitine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641]
+
* [[AGPT]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[ALGINATE-SYNTHASE-RXN]]
−
* [[PWY-7384]], anaerobic energy metabolism (invertebrates, mitochondrial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384]
+
* [[FE2GTPabc]]
−
** '''6''' reactions found over '''10''' reactions in the full pathway
+
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
−
== Reconstruction information  ==
+
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GBDP]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GTCY]]
−
== External links  ==
+
* [[GTUP]]
−
* RHEA:
+
* [[GUANYL-KIN-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12654 12654]
+
* [[MANNPGUANYLTRANGDP-RXN]]
−
* UNIPROT:
+
* [[PPGPPSYN-RXN]]
−
** [http://www.uniprot.org/uniprot/Q48662 Q48662]
+
* [[RXN-12486]]
−
** [http://www.uniprot.org/uniprot/Q9PN12 Q9PN12]
+
* [[RXN-15268]]
−
** [http://www.uniprot.org/uniprot/O59029 O59029]
+
* [[RXN-16602]]
−
** [http://www.uniprot.org/uniprot/P16468 P16468]
+
* [[RXN-5462]]
−
** [http://www.uniprot.org/uniprot/Q9CGB2 Q9CGB2]
+
* [[RXN-5463]]
−
** [http://www.uniprot.org/uniprot/P26616 P26616]
+
* [[RXN-5464]]
−
** [http://www.uniprot.org/uniprot/Q9JVE6 Q9JVE6]
+
* [[RXN-8988]]
−
** [http://www.uniprot.org/uniprot/P37224 P37224]
+
* [[RXN-9463]]
−
** [http://www.uniprot.org/uniprot/P37225 P37225]
+
* [[RXN0-5462]]
−
** [http://www.uniprot.org/uniprot/P37221 P37221]
+
* [[RXNQT-4141]]
−
** [http://www.uniprot.org/uniprot/Q7M1T9 Q7M1T9]
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
−
** [http://www.uniprot.org/uniprot/Q9M162 Q9M162]
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
−
* LIGAND-RXN:
+
* [[URKI-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00214 R00214]
+
</div>
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=malate dehydrogenase (decarboxylating) (nad+)|malate dehydrogenase, nad-requiring|oxaloacetate decarboxylase}}
+
{{#set: common-name=gdp}}
−
{{#set: ec-number=ec-1.1.1.39|ec-1.1.1.38}}
+
{{#set: inchi-key=inchikey=qgwndrxfnxrzmb-uuokfmhzsa-k}}
−
{{#set: nb gene associated=3}}
+
{{#set: molecular-weight=440.179}}
−
{{#set: nb pathway associated=6}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite GDP

  • common-name:
    • gdp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • qgwndrxfnxrzmb-uuokfmhzsa-k
  • molecular-weight:
    • 440.179

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PROPANOL&oldid=47428"