Difference between revisions of "PROPIONAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16767 == * transcription-direction: ** positive * right-end-position: ** 32270 * left-end-position: ** 30675 * centisome-position: ** 4.497517...")
(Created page with "Category:metabolite == Metabolite CPD0-2244 == * common-name: ** (s)-3-hydroxydecanoyl-coa * smiles: ** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16767 ==
+
== Metabolite CPD0-2244 ==
* transcription-direction:
+
* common-name:
** positive
+
** (s)-3-hydroxydecanoyl-coa
* right-end-position:
+
* smiles:
** 32270
+
** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
* left-end-position:
+
* inchi-key:
** 30675
+
** hivsmyzamunfkz-pnpvfpmqsa-j
* centisome-position:
+
* molecular-weight:
** 4.497517   
+
** 933.753
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ECOAH4h]]
== Reaction(s) associated ==
+
* [[HACD4h]]
* [[3.1.26.4-RXN]]
+
* [[RXN-12490]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ECOAH4h]]
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[HACD4h]]
** Category: [[annotation]]
+
* [[RXN-13616]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
{{#set: common-name=(s)-3-hydroxydecanoyl-coa}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=hivsmyzamunfkz-pnpvfpmqsa-j}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=933.753}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=32270}}
 
{{#set: left-end-position=30675}}
 
{{#set: centisome-position=4.497517    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD0-2244

  • common-name:
    • (s)-3-hydroxydecanoyl-coa
  • smiles:
    • cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • hivsmyzamunfkz-pnpvfpmqsa-j
  • molecular-weight:
    • 933.753

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality