Difference between revisions of "PROPIONAMIDE"

Revision as of 14:53, 5 January 2021

common-name:
- dna combined with exogenous dna to form a recombinational junction

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD0-2244 ==
+== Metabolite DNA-Combined-With-Exogenous-DNA ==
 * common-name:
-** (s)-3-hydroxydecanoyl-coa
+** dna combined with exogenous dna to form a recombinational junction
-* smiles:
-** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
-* inchi-key:
-** hivsmyzamunfkz-pnpvfpmqsa-j
-* molecular-weight:
-** 933.753
 == Reaction(s) known to consume the compound ==
-* [[ECOAH4h]]
+* [[3.1.22.4-RXN]]
-* [[HACD4h]]
-* [[RXN-12490]]
 == Reaction(s) known to produce the compound ==
-* [[ECOAH4h]]
-* [[HACD4h]]
-* [[RXN-13616]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxydecanoyl-coa}}
+{{#set: common-name=dna combined with exogenous dna to form a recombinational junction}}
-{{#set: inchi-key=inchikey=hivsmyzamunfkz-pnpvfpmqsa-j}}
-{{#set: molecular-weight=933.753}}