Difference between revisions of "PROPIONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o * inchi-key: ** ierhlvcpsmictf-xvfcmesi...") |
(Created page with "Category:metabolite == Metabolite PROPIONATE == * common-name: ** propanoate * smiles: ** ccc(=o)[o-] * inchi-key: ** xbdqkxxyiptubi-uhfffaoysa-m * molecular-weight: ** 73...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROPIONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** propanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xbdqkxxyiptubi-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 73.071 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[23-DIMETHYLMALATE-LYASE-RXN]] | |
| − | * [[ | + | * [[RXN-14727]] |
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=propanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xbdqkxxyiptubi-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=73.071}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite PROPIONATE
- common-name:
- propanoate
- smiles:
- ccc(=o)[o-]
- inchi-key:
- xbdqkxxyiptubi-uhfffaoysa-m
- molecular-weight:
- 73.071
