Difference between revisions of "PROPIONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8166 == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...")
(Created page with "Category:metabolite == Metabolite PROPIONATE == * common-name: ** propanoate * smiles: ** ccc(=o)[o-] * inchi-key: ** xbdqkxxyiptubi-uhfffaoysa-m * molecular-weight: ** 73...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8166 ==
+
== Metabolite PROPIONATE ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:3-monogalactosyldiacylglycerol
+
** propanoate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
+
** ccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** drlqfbrxasrgdp-bubqrnscsa-n
+
** xbdqkxxyiptubi-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 777.089
+
** 73.071
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8368]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8367]]
+
* [[23-DIMETHYLMALATE-LYASE-RXN]]
 +
* [[RXN-14727]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:3-monogalactosyldiacylglycerol}}
+
{{#set: common-name=propanoate}}
{{#set: inchi-key=inchikey=drlqfbrxasrgdp-bubqrnscsa-n}}
+
{{#set: inchi-key=inchikey=xbdqkxxyiptubi-uhfffaoysa-m}}
{{#set: molecular-weight=777.089}}
+
{{#set: molecular-weight=73.071}}

Latest revision as of 11:16, 18 March 2021

Metabolite PROPIONATE

  • common-name:
    • propanoate
  • smiles:
    • ccc(=o)[o-]
  • inchi-key:
    • xbdqkxxyiptubi-uhfffaoysa-m
  • molecular-weight:
    • 73.071

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality