Difference between revisions of "PROPIONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12371 == * transcription-direction: ** positive * right-end-position: ** 239154 * left-end-position: ** 229487 * centisome-position: ** 63.852276...")
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12371 ==
+
== Metabolite CPD-19158 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-oxo-(9z)-hexadecenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 239154
+
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 229487
+
** jdnargywmlyada-mdmkaecgsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 63.852276   
+
** 1013.883
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17791]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PEROXID-RXN]]
+
* [[RXN-17790]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
−
* [[RXN-14240]]
+
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=1013.883}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15288]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17352]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=239154}}
 
−
{{#set: left-end-position=229487}}
 
−
{{#set: centisome-position=63.852276    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-19158

  • common-name:
    • 3-oxo-(9z)-hexadecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jdnargywmlyada-mdmkaecgsa-j
  • molecular-weight:
    • 1013.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PROPIONYL-COA&oldid=47155"