Difference between revisions of "PROSTAGLANDIN-H2"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ECOAH5m ECOAH5m] == * direction: ** reversible * common-name: ** enoyl-coa hydratase (c12:0) == Rea...") |
(Created page with "Category:metabolite == Metabolite PROSTAGLANDIN-H2 == * common-name: ** prostaglandin-h2 * smiles: ** cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2)) * inchi-key: ** yibnh...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite PROSTAGLANDIN-H2 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** prostaglandin-h2 |
− | == | + | * smiles: |
− | + | ** cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2)) | |
− | + | * inchi-key: | |
− | * | + | ** yibnhajfjuqsra-ynnpmvkqsa-m |
− | ** | + | * molecular-weight: |
− | ** | + | ** 351.462 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[PROSTAGLANDIN-D-SYNTHASE-RXN]] | |
− | * | + | * [[PROSTAGLANDIN-E-SYNTHASE-RXN]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: common-name= | + | {{#set: common-name=prostaglandin-h2}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=yibnhajfjuqsra-ynnpmvkqsa-m}} |
− | + | {{#set: molecular-weight=351.462}} | |
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite PROSTAGLANDIN-H2
- common-name:
- prostaglandin-h2
- smiles:
- cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2))
- inchi-key:
- yibnhajfjuqsra-ynnpmvkqsa-m
- molecular-weight:
- 351.462