Difference between revisions of "PROSTAGLANDIN-H2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5781 RXN-5781] == * direction: ** reversible * common-name: ** 1,2-diacyl-sn-glycerol cholineph...")
(Created page with "Category:metabolite == Metabolite PROSTAGLANDIN-H2 == * common-name: ** prostaglandin-h2 * smiles: ** cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2)) * inchi-key: ** yibnh...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5781 RXN-5781] ==
+
== Metabolite PROSTAGLANDIN-H2 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** 1,2-diacyl-sn-glycerol cholinephosphotransferase
+
** prostaglandin-h2
** diacylglycerol cholinephosphotransferase
+
* smiles:
* ec-number:
+
** cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2))
** [http://enzyme.expasy.org/EC/2.7.8.2 ec-2.7.8.2]
+
* inchi-key:
== Reaction formula ==
+
** yibnhajfjuqsra-ynnpmvkqsa-m
* 1 [[CDP-CHOLINE]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''<=>''' 1 [[CMP]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 351.462
* Gene: [[SJ19317]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[PROSTAGLANDIN-D-SYNTHASE-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
* Gene: [[SJ06171]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=prostaglandin-h2}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=yibnhajfjuqsra-ynnpmvkqsa-m}}
* [[PWY-6804]], diacylglycerol biosynthesis (PUFA enrichment in oilseed): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6804 PWY-6804]
+
{{#set: molecular-weight=351.462}}
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY3O-450]], phosphatidylcholine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-450 PWY3O-450]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-7367]], phosphatidylcholine resynthesis via glycerophosphocholine: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7367 PWY-7367]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-3561]], choline biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3561 PWY-3561]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY4FS-2]], phosphatidylcholine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-2 PWY4FS-2]
 
** '''2''' reactions found over '''5''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32942 32942]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01321 R01321]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P17898 P17898]
 
{{#set: direction=reversible}}
 
{{#set: common-name=1,2-diacyl-sn-glycerol cholinephosphotransferase|diacylglycerol cholinephosphotransferase}}
 
{{#set: ec-number=ec-2.7.8.2}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=5}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite PROSTAGLANDIN-H2

  • common-name:
    • prostaglandin-h2
  • smiles:
    • cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2))
  • inchi-key:
    • yibnhajfjuqsra-ynnpmvkqsa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality