Difference between revisions of "PROT-CYS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-HEXOSE-6-PHOSPHATE == * common-name: ** d-hexose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** nbs...") |
(Created page with "Category:metabolite == Metabolite CPD-14760 == * common-name: ** furfuryl methyl sulfide * smiles: ** cscc1(=cc=co1) * inchi-key: ** sksfhxvdhvkibn-uhfffaoysa-n * molecula...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14760 == |
* common-name: | * common-name: | ||
− | ** | + | ** furfuryl methyl sulfide |
* smiles: | * smiles: | ||
− | ** | + | ** cscc1(=cc=co1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sksfhxvdhvkibn-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 128.189 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13727]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=furfuryl methyl sulfide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sksfhxvdhvkibn-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=128.189}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-14760
- common-name:
- furfuryl methyl sulfide
- smiles:
- cscc1(=cc=co1)
- inchi-key:
- sksfhxvdhvkibn-uhfffaoysa-n
- molecular-weight:
- 128.189