Difference between revisions of "PROT-CYS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...") |
(Created page with "Category:metabolite == Metabolite PROT-CYS == * common-name: ** a [protein]-l-cysteine == Reaction(s) known to consume the compound == * 1.11.1.15-RXN * 2.1.1.63-RXN...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROT-CYS == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-l-cysteine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.11.1.15-RXN]] |
| − | * [[ | + | * [[2.1.1.63-RXN]] |
| − | * [[ | + | * [[2.5.1.58-RXN]] |
| − | + | * [[RXN-14554]] | |
| − | * [[RXN- | + | * [[RXN-3701]] |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.5.1.58-RXN]] |
| − | * [[ | + | * [[RXN-16820]] |
| − | + | * [[RXN-3701]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-cysteine}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite PROT-CYS
- common-name:
- a [protein]-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
