Difference between revisions of "PROT-CYS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OH-MYRISTOYL == * common-name: ** udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine * smiles: ** cccccccccccc(cc(nc1(c(c...") |
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DADP == |
* common-name: | * common-name: | ||
− | ** | + | ** dadp |
* smiles: | * smiles: | ||
− | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** daeapnuqqaicnr-rrkcrqdmsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 408.18 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DADPKIN-RXN]] | ||
+ | * [[DATPtm]] | ||
+ | * [[NDPK]] | ||
+ | * [[NDPKm]] | ||
+ | * [[RXN-14192]] | ||
+ | * [[RXN-14215]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ADPREDUCT-RXN]] |
+ | * [[ATDAM]] | ||
+ | * [[DAOTO]] | ||
+ | * [[DATCY]] | ||
+ | * [[DATPtm]] | ||
+ | * [[DATUP]] | ||
+ | * [[DEOXYADENYLATE-KINASE-RXN]] | ||
+ | * [[RXN-14214]] | ||
+ | * [[RXN0-747]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dadp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=408.18}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite DADP
- common-name:
- dadp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
- inchi-key:
- daeapnuqqaicnr-rrkcrqdmsa-k
- molecular-weight:
- 408.18