Difference between revisions of "PROTEIN-C-TERMINAL-S-ETC-CYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...") |
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine == Reaction(s) known to consume the c...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein] c-terminal s-farnesyl-l-cysteine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[1. | + | * [[2.1.1.100-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-11698]] | |
− | + | * [[RXN-8409]] | |
− | |||
− | |||
− | * [[RXN- | ||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE
- common-name:
- a [protein] c-terminal s-farnesyl-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein] c-terminal s-farnesyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.