Difference between revisions of "PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine methyl ester == Reaction(s) kn...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein] c-terminal s-farnesyl-l-cysteine methyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-8409]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[1. | + | * [[2.1.1.100-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine methyl ester}} |
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE
- common-name:
- a [protein] c-terminal s-farnesyl-l-cysteine methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein] c-terminal s-farnesyl-l-cysteine methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
