Difference between revisions of "PROTEIN-L-BETA-ISOASPARTATES"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1o)=o)o)o) * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-...") |
(Created page with "Category:metabolite == Metabolite DEOXY-RIBOSE-5P == * common-name: ** 2-deoxy-d-ribose 5-phosphate == Reaction(s) known to consume the compound == * D-PPENTOMUT-RXN =...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXY-RIBOSE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-deoxy-d-ribose 5-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[D-PPENTOMUT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[D-PPENTOMUT-RXN]] |
| + | * [[RXN-14223]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-deoxy-d-ribose 5-phosphate}} |
| − | |||
| − | |||
Revision as of 08:26, 15 March 2021
Contents
Metabolite DEOXY-RIBOSE-5P
- common-name:
- 2-deoxy-d-ribose 5-phosphate
