Difference between revisions of "PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(=c(o)c=cc=c1) * inchi-key: ** ccvyrrgzdbshfu-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS == * common-name: ** a protein l-β-isoaspartate α-methyl ester == Reaction(s) known t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS == |
* common-name: | * common-name: | ||
| − | ** | + | ** a protein l-β-isoaspartate α-methyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.1.1.77-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a protein l-β-isoaspartate α-methyl ester}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS
- common-name:
- a protein l-β-isoaspartate α-methyl ester
