Difference between revisions of "PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) * inchi-key: ** vevzs...")
(Created page with "Category:metabolite == Metabolite Aryl-Dialkyl-Phosphate == * common-name: ** an aryl dialkyl phosphate == Reaction(s) known to consume the compound == * ARYLDIALKYLPHOS...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-591 ==
+
== Metabolite Aryl-Dialkyl-Phosphate ==
 
* common-name:
 
* common-name:
** cyanidin
+
** an aryl dialkyl phosphate
* smiles:
 
** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
 
* inchi-key:
 
** vevzsmaejfvwil-uhfffaoysa-m
 
* molecular-weight:
 
** 285.232
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9725]]
+
* [[ARYLDIALKYLPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyanidin}}
+
{{#set: common-name=an aryl dialkyl phosphate}}
{{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}}
 
{{#set: molecular-weight=285.232}}
 

Revision as of 15:27, 5 January 2021

Metabolite Aryl-Dialkyl-Phosphate

  • common-name:
    • an aryl dialkyl phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality