Difference between revisions of "PROTEIN-L-CITRULLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2181 == * common-name: ** 1-oleoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-...")
(Created page with "Category:metabolite == Metabolite PROTEIN-L-CITRULLINE == * common-name: ** a [protein]-l-citrulline == Reaction(s) known to consume the compound == == Reaction(s) known t...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2181 ==
+
== Metabolite PROTEIN-L-CITRULLINE ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-oleoyl-phosphatidylcholine
+
** a [protein]-l-citrulline
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** snkawjbjqdlsff-nvkmucnasa-n
 
* molecular-weight:
 
** 786.123
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8320]]
 
* [[RXN-8327]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=a [protein]-l-citrulline}}
{{#set: inchi-key=inchikey=snkawjbjqdlsff-nvkmucnasa-n}}
 
{{#set: molecular-weight=786.123}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite PROTEIN-L-CITRULLINE

  • common-name:
    • a [protein]-l-citrulline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-citrulline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.