Difference between revisions of "PROTEIN-L-CITRULLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O == * common-name: ** prostaglandin d2 * smiles: ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) * in...") |
(Created page with "Category:metabolite == Metabolite PROTEIN-L-CITRULLINE == * common-name: ** a [protein]-l-citrulline == Reaction(s) known to consume the compound == == Reaction(s) known t...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PROTEIN-L-CITRULLINE == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-citrulline |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PROTEIN-ARGININE-DEIMINASE-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-citrulline}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite PROTEIN-L-CITRULLINE
- common-name:
- a [protein]-l-citrulline
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-citrulline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.