Difference between revisions of "PROTEIN-L-CITRULLINE"

Revision as of 13:09, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-2181 ==
+== Metabolite RIBULOSE-5P ==
 * common-name:
-** 1-oleoyl-2-oleoyl-phosphatidylcholine
+** d-ribulose 5-phosphate
 * smiles:
-** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+** c(c(c(c(co)=o)o)o)op([o-])([o-])=o
 * inchi-key:
-** snkawjbjqdlsff-nvkmucnasa-n
+** fnzlkvnuwiipsj-uhnvwzdzsa-l
 * molecular-weight:
-** 786.123
+** 228.095
 == Reaction(s) known to consume the compound ==
-* [[RXN-8320]]
+* [[DIOHBUTANONEPSYN-RXN]]
-* [[RXN-8327]]
+* [[PHOSPHORIBULOKINASE-RXN]]
+* [[RIB5PISOM-RXN]]
+* [[RIBULP3EPIM-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[6PGLUCONDEHYDROG-RXN]]
+* [[PHOSPHORIBULOKINASE-RXN]]
+* [[RIB5PISOM-RXN]]
+* [[RIBULP3EPIM-RXN]]
+* [[RXN-3341]]
+* [[RXN-9952]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-oleoyl-2-oleoyl-phosphatidylcholine}}
+{{#set: common-name=d-ribulose 5-phosphate}}
-{{#set: inchi-key=inchikey=snkawjbjqdlsff-nvkmucnasa-n}}
+{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}}
-{{#set: molecular-weight=786.123}}
+{{#set: molecular-weight=228.095}}