Difference between revisions of "PROTEIN-N-UBIQUITYL-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-505 == * common-name: ** d-myo-inositol (1,3,4,6)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op...")
(Created page with "Category:metabolite == Metabolite CPD-2752 == * common-name: ** trans-3-hydroxycotinine-glucuronide * smiles: ** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-505 ==
+
== Metabolite CPD-2752 ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,6)-tetrakisphosphate
+
** trans-3-hydroxycotinine-glucuronide
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
 
* inchi-key:
 
* inchi-key:
** zawixngttztbkv-jmvowjsssa-f
+
** walnnkzughysct-mbwyjtgfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 492.013
+
** 367.335
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.140-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.133-RXN]]
+
* [[RXN66-162]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,6)-tetrakisphosphate}}
+
{{#set: common-name=trans-3-hydroxycotinine-glucuronide}}
{{#set: inchi-key=inchikey=zawixngttztbkv-jmvowjsssa-f}}
+
{{#set: inchi-key=inchikey=walnnkzughysct-mbwyjtgfsa-m}}
{{#set: molecular-weight=492.013}}
+
{{#set: molecular-weight=367.335}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-2752

  • common-name:
    • trans-3-hydroxycotinine-glucuronide
  • smiles:
    • c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
  • inchi-key:
    • walnnkzughysct-mbwyjtgfsa-m
  • molecular-weight:
    • 367.335

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality