Difference between revisions of "PROTEIN-N-UBIQUITYL-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2752 == * common-name: ** trans-3-hydroxycotinine-glucuronide * smiles: ** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=c...")
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2752 ==
+
== Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE ==
 
* common-name:
 
* common-name:
** trans-3-hydroxycotinine-glucuronide
+
** 3-hexaprenyl-4-hydroxybenzoate
 
* smiles:
 
* smiles:
** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** walnnkzughysct-mbwyjtgfsa-m
+
** lkmqqqabigihgl-laaqxviisa-m
 
* molecular-weight:
 
* molecular-weight:
** 367.335
+
** 545.824
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-162]]
+
* [[RXN-9003]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-3-hydroxycotinine-glucuronide}}
+
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
{{#set: inchi-key=inchikey=walnnkzughysct-mbwyjtgfsa-m}}
+
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
{{#set: molecular-weight=367.335}}
+
{{#set: molecular-weight=545.824}}

Revision as of 13:09, 14 January 2021

Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE

  • common-name:
    • 3-hexaprenyl-4-hydroxybenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
  • inchi-key:
    • lkmqqqabigihgl-laaqxviisa-m
  • molecular-weight:
    • 545.824

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality