Difference between revisions of "PROTON"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)...")
(Created page with "Category:metabolite == Metabolite CH3-MALONATE-S-ALD == * common-name: ** (s)-methylmalonate-semialdehyde * smiles: ** cc([ch]=o)c(=o)[o-] * inchi-key: ** vokumxabrrxhar-v...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3Z-PHYTOCHROMOBILIN ==
+
== Metabolite CH3-MALONATE-S-ALD ==
 
* common-name:
 
* common-name:
** (3z)-phytochromobilin
+
** (s)-methylmalonate-semialdehyde
 
* smiles:
 
* smiles:
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
+
** cc([ch]=o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** dkmlmzvdtgoegu-aikfxvfzsa-l
+
** vokumxabrrxhar-vkhmyheasa-m
 
* molecular-weight:
 
* molecular-weight:
** 582.655
+
** 101.082
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11213]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.4-RXN]]
+
* [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-phytochromobilin}}
+
{{#set: common-name=(s)-methylmalonate-semialdehyde}}
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
+
{{#set: inchi-key=inchikey=vokumxabrrxhar-vkhmyheasa-m}}
{{#set: molecular-weight=582.655}}
+
{{#set: molecular-weight=101.082}}

Revision as of 18:56, 14 January 2021

Metabolite CH3-MALONATE-S-ALD

  • common-name:
    • (s)-methylmalonate-semialdehyde
  • smiles:
    • cc([ch]=o)c(=o)[o-]
  • inchi-key:
    • vokumxabrrxhar-vkhmyheasa-m
  • molecular-weight:
    • 101.082

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality