Difference between revisions of "PROTOPORPHYRINOGEN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METHYLARSONATE == * common-name: ** methylarsonate * smiles: ** c[as](=o)([o-])o * inchi-key: ** qypprtnmgcreim-uhfffaoysa-m * molecular-...") |
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PROTOPORPHYRINOGEN == |
* common-name: | * common-name: | ||
− | ** | + | ** protoporphyrinogen ix |
* smiles: | * smiles: | ||
− | ** c[ | + | ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uhsgpdmiqqynax-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 566.699 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[PPPGO]] | ||
+ | * [[PROTOPORGENOXI-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HEMN-RXN]] |
+ | * [[RXN0-1461]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=protoporphyrinogen ix}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=566.699}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite PROTOPORPHYRINOGEN
- common-name:
- protoporphyrinogen ix
- smiles:
- c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
- inchi-key:
- uhsgpdmiqqynax-uhfffaoysa-l
- molecular-weight:
- 566.699